C28H35BrO4SSi — CID 10951968
(2S,3R,5S)-6-(benzenesulfinyl)-2-bromo-5-[tert-butyl(diphenyl)silyl]oxyhexane-1,3-diol (PubChem CID 10951968) has the molecular formula C28H35BrO4SSi and a molecular weight of 575.64 g/mol. Its IUPAC name is (2S,3R,5S)-6-(benzenesulfinyl)-2-bromo-5-[tert-butyl(diphenyl)silyl]oxyhexane-1,3-diol.
| Compound Name | (2S,3R,5S)-6-(benzenesulfinyl)-2-bromo-5-[tert-butyl(diphenyl)silyl]oxyhexane-1,3-diol |
|---|---|
| PubChem CID | 10951968 |
| Molecular Formula | C28H35BrO4SSi |
| Molecular Weight | 575.64 g/mol |
| Exact Mass | 574.12 |
| IUPAC Name | (2S,3R,5S)-6-(benzenesulfinyl)-2-bromo-5-[tert-butyl(diphenyl)silyl]oxyhexane-1,3-diol |
| SMILES | CC(C)(C)[Si](O[C@@H](C[C@@H](O)[C@@H](Br)CO)CS(=O)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H35BrO4SSi/c1-28(2,3)35(24-15-9-5-10-16-24,25-17-11-6-12-18-25)33-22(19-27(31)26(29)20-30)21-34(32)23-13-7-4-8-14-23/h4-18,22,26-27,30-31H,19-21H2,1-3H3/t22-,26-,27+,34?/m0/s1 |
| InChIKey | RMAMSPGCJHAEJV-DGFYOICHSA-N |
| XLogP | 4.25 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.64 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|