C31H39BrO4SSi — CID 10908247
[(2S)-1-(benzenesulfinyl)-3-[(4R,5S)-5-bromo-2,2-dimethyl-1,3-dioxan-4-yl]propan-2-yl]oxy-tert-butyl-diphenylsilane (PubChem CID 10908247) has the molecular formula C31H39BrO4SSi and a molecular weight of 615.71 g/mol. Its IUPAC name is [(2S)-1-(benzenesulfinyl)-3-[(4R,5S)-5-bromo-2,2-dimethyl-1,3-dioxan-4-yl]propan-2-yl]oxy-tert-butyl-diphenylsilane.
| Compound Name | [(2S)-1-(benzenesulfinyl)-3-[(4R,5S)-5-bromo-2,2-dimethyl-1,3-dioxan-4-yl]propan-2-yl]oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 10908247 |
| Molecular Formula | C31H39BrO4SSi |
| Molecular Weight | 615.71 g/mol |
| Exact Mass | 614.15 |
| IUPAC Name | [(2S)-1-(benzenesulfinyl)-3-[(4R,5S)-5-bromo-2,2-dimethyl-1,3-dioxan-4-yl]propan-2-yl]oxy-tert-butyl-diphenylsilane |
| SMILES | CC1(C)OC[C@H](Br)[C@@H](C[C@@H](CS(=O)c2ccccc2)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C31H39BrO4SSi/c1-30(2,3)38(26-17-11-7-12-18-26,27-19-13-8-14-20-27)36-24(23-37(33)25-15-9-6-10-16-25)21-29-28(32)22-34-31(4,5)35-29/h6-20,24,28-29H,21-23H2,1-5H3/t24-,28-,29+,37?/m0/s1 |
| InChIKey | NTMYITDSLRWKBP-LORXTOJASA-N |
| XLogP | 6.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.71 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|