C18H27BrO4SSi — CID 10551397
(1S,4R,5S,6S)-4-(benzenesulfonyl)-6-bromo-5-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-ol (PubChem CID 10551397) has the molecular formula C18H27BrO4SSi and a molecular weight of 447.47 g/mol. Its IUPAC name is (1S,4R,5S,6S)-4-(benzenesulfonyl)-6-bromo-5-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-ol.
| Compound Name | (1S,4R,5S,6S)-4-(benzenesulfonyl)-6-bromo-5-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 10551397 |
| Molecular Formula | C18H27BrO4SSi |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | (1S,4R,5S,6S)-4-(benzenesulfonyl)-6-bromo-5-[tert-butyl(dimethyl)silyl]oxycyclohex-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](Br)[C@@H](O)C=C[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H27BrO4SSi/c1-18(2,3)25(4,5)23-17-15(12-11-14(20)16(17)19)24(21,22)13-9-7-6-8-10-13/h6-12,14-17,20H,1-5H3/t14-,15+,16-,17-/m0/s1 |
| InChIKey | DHTLKZMLTGVNCP-YVSFHVDLSA-N |
| XLogP | 3.91 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|