C20H32O4SSi — CID 11223219
(1S,4R,5S,6S)-3-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylcyclohex-2-en-1-ol (PubChem CID 11223219) has the molecular formula C20H32O4SSi and a molecular weight of 396.63 g/mol. Its IUPAC name is (1S,4R,5S,6S)-3-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylcyclohex-2-en-1-ol.
| Compound Name | (1S,4R,5S,6S)-3-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 11223219 |
| Molecular Formula | C20H32O4SSi |
| Molecular Weight | 396.63 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (1S,4R,5S,6S)-3-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylcyclohex-2-en-1-ol |
| SMILES | C[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(S(=O)(=O)c2ccccc2)=C[C@H]1O |
| InChI | InChI=1S/C20H32O4SSi/c1-14-17(21)13-18(25(22,23)16-11-9-8-10-12-16)15(2)19(14)24-26(6,7)20(3,4)5/h8-15,17,19,21H,1-7H3/t14-,15-,17+,19-/m0/s1 |
| InChIKey | UHGSNNPOQWAONA-BVYOLEPJSA-N |
| XLogP | 4.38 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.63 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|