C22H36O3SSi — CID 10549449
(1R,4R)-3-[2-(benzenesulfinyl)ethyl]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylcyclohex-2-en-1-ol (PubChem CID 10549449) has the molecular formula C22H36O3SSi and a molecular weight of 408.68 g/mol. Its IUPAC name is (1R,4R)-3-[2-(benzenesulfinyl)ethyl]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylcyclohex-2-en-1-ol.
| Compound Name | (1R,4R)-3-[2-(benzenesulfinyl)ethyl]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 10549449 |
| Molecular Formula | C22H36O3SSi |
| Molecular Weight | 408.68 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | (1R,4R)-3-[2-(benzenesulfinyl)ethyl]-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylcyclohex-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@]1(C)CC[C@@H](O)C=C1CCS(=O)c1ccccc1 |
| InChI | InChI=1S/C22H36O3SSi/c1-21(2,3)27(5,6)25-17-22(4)14-12-19(23)16-18(22)13-15-26(24)20-10-8-7-9-11-20/h7-11,16,19,23H,12-15,17H2,1-6H3/t19-,22+,26?/m1/s1 |
| InChIKey | ZABQXMJFSDZWQX-GCQDHQGHSA-N |
| XLogP | 5.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.68 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|