C32H50O4SSi — CID 155934912
(2E,6E)-1-[(4R,5S)-5-(benzenesulfonylmethyl)-4,5-dimethyl-6-methylidenecyclohexen-1-yl]-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylocta-2,6-dien-1-ol (PubChem CID 155934912) has the molecular formula C32H50O4SSi and a molecular weight of 558.90 g/mol. Its IUPAC name is (2E,6E)-1-[(4R,5S)-5-(benzenesulfonylmethyl)-4,5-dimethyl-6-methylidenecyclohexen-1-yl]-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylocta-2,6-dien-1-ol.
| Compound Name | (2E,6E)-1-[(4R,5S)-5-(benzenesulfonylmethyl)-4,5-dimethyl-6-methylidenecyclohexen-1-yl]-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylocta-2,6-dien-1-ol |
|---|---|
| PubChem CID | 155934912 |
| Molecular Formula | C32H50O4SSi |
| Molecular Weight | 558.90 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | (2E,6E)-1-[(4R,5S)-5-(benzenesulfonylmethyl)-4,5-dimethyl-6-methylidenecyclohexen-1-yl]-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylocta-2,6-dien-1-ol |
| SMILES | C=C1C(C(O)/C=C(\C)CC/C=C(\C)CO[Si](C)(C)C(C)(C)C)=CC[C@@H](C)[C@]1(C)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H50O4SSi/c1-24(15-14-16-25(2)22-36-38(9,10)31(5,6)7)21-30(33)29-20-19-26(3)32(8,27(29)4)23-37(34,35)28-17-12-11-13-18-28/h11-13,16-18,20-21,26,30,33H,4,14-15,19,22-23H2,1-3,5-10H3/b24-21+,25-16+/t26-,30?,32+/m1/s1 |
| InChIKey | PPBHCTANXULTPI-GTUKXMNESA-N |
| XLogP | 8.04 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.90 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|