C27H42O4SSi — CID 10814952
(3R,4aS,5R,8S,9Z,10aS)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-3,4,4a,5,6,8-hexahydrobenzo[8]annulen-3-ol (PubChem CID 10814952) has the molecular formula C27H42O4SSi and a molecular weight of 490.78 g/mol. Its IUPAC name is (3R,4aS,5R,8S,9Z,10aS)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-3,4,4a,5,6,8-hexahydrobenzo[8]annulen-3-ol.
| Compound Name | (3R,4aS,5R,8S,9Z,10aS)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-3,4,4a,5,6,8-hexahydrobenzo[8]annulen-3-ol |
|---|---|
| PubChem CID | 10814952 |
| Molecular Formula | C27H42O4SSi |
| Molecular Weight | 490.78 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | (3R,4aS,5R,8S,9Z,10aS)-5-(benzenesulfonyl)-8-[tert-butyl(dimethyl)silyl]oxy-7,7,10a-trimethyl-3,4,4a,5,6,8-hexahydrobenzo[8]annulen-3-ol |
| SMILES | CC1(C)C[C@@H](S(=O)(=O)c2ccccc2)[C@H]2C[C@@H](O)C=C[C@@]2(C)/C=C\[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H42O4SSi/c1-25(2,3)33(7,8)31-24-15-17-27(6)16-14-20(28)18-22(27)23(19-26(24,4)5)32(29,30)21-12-10-9-11-13-21/h9-17,20,22-24,28H,18-19H2,1-8H3/b17-15-/t20-,22+,23+,24-,27-/m0/s1 |
| InChIKey | FKLKQFGWVRCRBT-JVUGUDQASA-N |
| XLogP | 6.15 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.78 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|