C22H34O3SSi2 — CID 135019001
[2-[1,3-bis(trimethylsilyl)propan-2-ylsulfonyl]phenyl]-phenylmethanol (PubChem CID 135019001) has the molecular formula C22H34O3SSi2 and a molecular weight of 434.75 g/mol. Its IUPAC name is [2-[1,3-bis(trimethylsilyl)propan-2-ylsulfonyl]phenyl]-phenylmethanol.
| Compound Name | [2-[1,3-bis(trimethylsilyl)propan-2-ylsulfonyl]phenyl]-phenylmethanol |
|---|---|
| PubChem CID | 135019001 |
| Molecular Formula | C22H34O3SSi2 |
| Molecular Weight | 434.75 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | [2-[1,3-bis(trimethylsilyl)propan-2-ylsulfonyl]phenyl]-phenylmethanol |
| SMILES | C[Si](C)(C)CC(C[Si](C)(C)C)S(=O)(=O)c1ccccc1C(O)c1ccccc1 |
| InChI | InChI=1S/C22H34O3SSi2/c1-27(2,3)16-19(17-28(4,5)6)26(24,25)21-15-11-10-14-20(21)22(23)18-12-8-7-9-13-18/h7-15,19,22-23H,16-17H2,1-6H3 |
| InChIKey | MYGATAPGHNADMQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.75 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|