C41H60O4SSi2 — CID 11285501
(1R,2S,5S)-1-(benzenesulfinylmethyl)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,5-dimethylcyclohex-3-en-1-ol (PubChem CID 11285501) has the molecular formula C41H60O4SSi2 and a molecular weight of 705.17 g/mol. Its IUPAC name is (1R,2S,5S)-1-(benzenesulfinylmethyl)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,5-dimethylcyclohex-3-en-1-ol.
| Compound Name | (1R,2S,5S)-1-(benzenesulfinylmethyl)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,5-dimethylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 11285501 |
| Molecular Formula | C41H60O4SSi2 |
| Molecular Weight | 705.17 g/mol |
| Exact Mass | 704.38 |
| IUPAC Name | (1R,2S,5S)-1-(benzenesulfinylmethyl)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,5-dimethylcyclohex-3-en-1-ol |
| SMILES | C[C@H]1C[C@](O)(CS(=O)c2ccccc2)[C@@](C)(CCCO[Si](C)(C)C(C)(C)C)C=C1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C41H60O4SSi2/c1-33-29-41(42,32-46(43)35-21-14-11-15-22-35)40(8,27-20-28-44-47(9,10)38(2,3)4)30-34(33)31-45-48(39(5,6)7,36-23-16-12-17-24-36)37-25-18-13-19-26-37/h11-19,21-26,30,33,42H,20,27-29,31-32H2,1-10H3/t33-,40-,41-,46?/m0/s1 |
| InChIKey | WFBNCUQAOSBYIU-OAHJIIRTSA-N |
| XLogP | 8.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.17 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|