C43H64O5SSi2 — CID 11343186
(6S,7R,10E)-4-(benzenesulfonyl)-12-[tert-butyl(diphenyl)silyl]oxy-2,6,10-trimethyl-7-triethylsilyloxydodeca-2,10-dien-6-ol (PubChem CID 11343186) has the molecular formula C43H64O5SSi2 and a molecular weight of 749.22 g/mol. Its IUPAC name is (6S,7R,10E)-4-(benzenesulfonyl)-12-[tert-butyl(diphenyl)silyl]oxy-2,6,10-trimethyl-7-triethylsilyloxydodeca-2,10-dien-6-ol.
| Compound Name | (6S,7R,10E)-4-(benzenesulfonyl)-12-[tert-butyl(diphenyl)silyl]oxy-2,6,10-trimethyl-7-triethylsilyloxydodeca-2,10-dien-6-ol |
|---|---|
| PubChem CID | 11343186 |
| Molecular Formula | C43H64O5SSi2 |
| Molecular Weight | 749.22 g/mol |
| Exact Mass | 748.40 |
| IUPAC Name | (6S,7R,10E)-4-(benzenesulfonyl)-12-[tert-butyl(diphenyl)silyl]oxy-2,6,10-trimethyl-7-triethylsilyloxydodeca-2,10-dien-6-ol |
| SMILES | CC[Si](CC)(CC)O[C@H](CC/C(C)=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@](C)(O)CC(C=C(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C43H64O5SSi2/c1-11-50(12-2,13-3)48-41(43(10,44)34-38(33-35(4)5)49(45,46)37-23-17-14-18-24-37)30-29-36(6)31-32-47-51(42(7,8)9,39-25-19-15-20-26-39)40-27-21-16-22-28-40/h14-28,31,33,38,41,44H,11-13,29-30,32,34H2,1-10H3/b36-31+/t38?,41-,43+/m1/s1 |
| InChIKey | GUHGOGAHHVBFTM-QJZFJSSGSA-N |
| XLogP | 9.63 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.22 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|