C32H54O5SSi2 — CID 3804243
8-(benzenesulfonyl)-15-[tert-butyl(dimethyl)silyl]oxy-6,10-dimethyl-1-trimethylsilylpentadeca-9,13-dien-1-yne-5,6-diol (PubChem CID 3804243) has the molecular formula C32H54O5SSi2 and a molecular weight of 607.02 g/mol. Its IUPAC name is 8-(benzenesulfonyl)-15-[tert-butyl(dimethyl)silyl]oxy-6,10-dimethyl-1-trimethylsilylpentadeca-9,13-dien-1-yne-5,6-diol.
| Compound Name | 8-(benzenesulfonyl)-15-[tert-butyl(dimethyl)silyl]oxy-6,10-dimethyl-1-trimethylsilylpentadeca-9,13-dien-1-yne-5,6-diol |
|---|---|
| PubChem CID | 3804243 |
| Molecular Formula | C32H54O5SSi2 |
| Molecular Weight | 607.02 g/mol |
| Exact Mass | 606.32 |
| IUPAC Name | 8-(benzenesulfonyl)-15-[tert-butyl(dimethyl)silyl]oxy-6,10-dimethyl-1-trimethylsilylpentadeca-9,13-dien-1-yne-5,6-diol |
| SMILES | CC(=CC(CC(C)(O)C(O)CCC#C[Si](C)(C)C)S(=O)(=O)c1ccccc1)CCC=CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H54O5SSi2/c1-27(19-13-12-17-23-37-40(9,10)31(2,3)4)25-29(38(35,36)28-20-14-11-15-21-28)26-32(5,34)30(33)22-16-18-24-39(6,7)8/h11-12,14-15,17,20-21,25,29-30,33-34H,13,16,19,22-23,26H2,1-10H3 |
| InChIKey | WCUZPHRTMOZVOF-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.02 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|