C20H34O4SSi — CID 134930776
(E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-(4-methylphenyl)sulfonylhex-3-en-2-ol (PubChem CID 134930776) has the molecular formula C20H34O4SSi and a molecular weight of 398.64 g/mol. Its IUPAC name is (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-(4-methylphenyl)sulfonylhex-3-en-2-ol.
| Compound Name | (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-(4-methylphenyl)sulfonylhex-3-en-2-ol |
|---|---|
| PubChem CID | 134930776 |
| Molecular Formula | C20H34O4SSi |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-(4-methylphenyl)sulfonylhex-3-en-2-ol |
| SMILES | Cc1ccc(S(=O)(=O)C[C@@H](/C=C/C(C)(C)O)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H34O4SSi/c1-16-9-11-18(12-10-16)25(22,23)15-17(13-14-20(5,6)21)24-26(7,8)19(2,3)4/h9-14,17,21H,15H2,1-8H3/b14-13+/t17-/m1/s1 |
| InChIKey | POZHBVDKDKHQQH-TUQDCPSNSA-N |
| XLogP | 4.49 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|