C18H30O3S2Si — CID 14133375
tert-butyl-dimethyl-[(E,2S)-4-(4-methylphenyl)sulfonyl-4-methylsulfanylbut-3-en-2-yl]oxysilane (PubChem CID 14133375) has the molecular formula C18H30O3S2Si and a molecular weight of 386.66 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E,2S)-4-(4-methylphenyl)sulfonyl-4-methylsulfanylbut-3-en-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(E,2S)-4-(4-methylphenyl)sulfonyl-4-methylsulfanylbut-3-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 14133375 |
| Molecular Formula | C18H30O3S2Si |
| Molecular Weight | 386.66 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | tert-butyl-dimethyl-[(E,2S)-4-(4-methylphenyl)sulfonyl-4-methylsulfanylbut-3-en-2-yl]oxysilane |
| SMILES | CS/C(=C\[C@H](C)O[Si](C)(C)C(C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H30O3S2Si/c1-14-9-11-16(12-10-14)23(19,20)17(22-6)13-15(2)21-24(7,8)18(3,4)5/h9-13,15H,1-8H3/b17-13+/t15-/m0/s1 |
| InChIKey | CWXWEAMMCSODIB-XOAFGZPJSA-N |
| XLogP | 5.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.66 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|