C17H26O3SSi — CID 11221450
tert-butyl-dimethyl-[4-(4-methylphenyl)sulfonyl-2,3-dihydrofuran-5-yl]silane (PubChem CID 11221450) has the molecular formula C17H26O3SSi and a molecular weight of 338.55 g/mol. Its IUPAC name is tert-butyl-dimethyl-[4-(4-methylphenyl)sulfonyl-2,3-dihydrofuran-5-yl]silane.
| Compound Name | tert-butyl-dimethyl-[4-(4-methylphenyl)sulfonyl-2,3-dihydrofuran-5-yl]silane |
|---|---|
| PubChem CID | 11221450 |
| Molecular Formula | C17H26O3SSi |
| Molecular Weight | 338.55 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | tert-butyl-dimethyl-[4-(4-methylphenyl)sulfonyl-2,3-dihydrofuran-5-yl]silane |
| SMILES | Cc1ccc(S(=O)(=O)C2=C([Si](C)(C)C(C)(C)C)OCC2)cc1 |
| InChI | InChI=1S/C17H26O3SSi/c1-13-7-9-14(10-8-13)21(18,19)15-11-12-20-16(15)22(5,6)17(2,3)4/h7-10H,11-12H2,1-6H3 |
| InChIKey | LTQGHFICMAODGK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|