C22H36O4SSi — CID 11418855
tert-butyl-[4-(3,4-dihydro-2H-pyran-6-yl)-4-(4-methylphenyl)sulfonylbutoxy]-dimethylsilane (PubChem CID 11418855) has the molecular formula C22H36O4SSi and a molecular weight of 424.68 g/mol. Its IUPAC name is tert-butyl-[4-(3,4-dihydro-2H-pyran-6-yl)-4-(4-methylphenyl)sulfonylbutoxy]-dimethylsilane.
| Compound Name | tert-butyl-[4-(3,4-dihydro-2H-pyran-6-yl)-4-(4-methylphenyl)sulfonylbutoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11418855 |
| Molecular Formula | C22H36O4SSi |
| Molecular Weight | 424.68 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | tert-butyl-[4-(3,4-dihydro-2H-pyran-6-yl)-4-(4-methylphenyl)sulfonylbutoxy]-dimethylsilane |
| SMILES | Cc1ccc(S(=O)(=O)C(CCCO[Si](C)(C)C(C)(C)C)C2=CCCCO2)cc1 |
| InChI | InChI=1S/C22H36O4SSi/c1-18-12-14-19(15-13-18)27(23,24)21(20-10-7-8-16-25-20)11-9-17-26-28(5,6)22(2,3)4/h10,12-15,21H,7-9,11,16-17H2,1-6H3 |
| InChIKey | CNHSHBHRSYCXNT-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.68 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|