C18H32O5SSi2 — CID 138971609
triethoxy-[(Z)-1-(4-methylphenyl)sulfonyl-2-trimethylsilylethenyl]silane (PubChem CID 138971609) has the molecular formula C18H32O5SSi2 and a molecular weight of 416.69 g/mol. Its IUPAC name is triethoxy-[(Z)-1-(4-methylphenyl)sulfonyl-2-trimethylsilylethenyl]silane.
| Compound Name | triethoxy-[(Z)-1-(4-methylphenyl)sulfonyl-2-trimethylsilylethenyl]silane |
|---|---|
| PubChem CID | 138971609 |
| Molecular Formula | C18H32O5SSi2 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | triethoxy-[(Z)-1-(4-methylphenyl)sulfonyl-2-trimethylsilylethenyl]silane |
| SMILES | CCO[Si](OCC)(OCC)/C(=C/[Si](C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H32O5SSi2/c1-8-21-26(22-9-2,23-10-3)18(15-25(5,6)7)24(19,20)17-13-11-16(4)12-14-17/h11-15H,8-10H2,1-7H3/b18-15+ |
| InChIKey | DWHWAOOZUDEDDX-OBGWFSINSA-N |
| XLogP | 4.12 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|