C25H48O5SSi2 — CID 10962352
[(2S,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpentyl] 4-methylbenzenesulfonate (PubChem CID 10962352) has the molecular formula C25H48O5SSi2 and a molecular weight of 516.89 g/mol. Its IUPAC name is [(2S,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpentyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10962352 |
| Molecular Formula | C25H48O5SSi2 |
| Molecular Weight | 516.89 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | [(2S,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](C)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H48O5SSi2/c1-20-13-15-22(16-14-20)31(26,27)28-19-21(2)23(30-33(11,12)25(6,7)8)17-18-29-32(9,10)24(3,4)5/h13-16,21,23H,17-19H2,1-12H3/t21-,23-/m0/s1 |
| InChIKey | VZAJWFCNTUJXPQ-GMAHTHKFSA-N |
| XLogP | 7.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.89 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|