C25H36O4SSi — CID 10961551
[(E,2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-methyl-5-phenylpent-4-enyl] 4-methylbenzenesulfonate (PubChem CID 10961551) has the molecular formula C25H36O4SSi and a molecular weight of 460.71 g/mol. Its IUPAC name is [(E,2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-methyl-5-phenylpent-4-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(E,2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-methyl-5-phenylpent-4-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10961551 |
| Molecular Formula | C25H36O4SSi |
| Molecular Weight | 460.71 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | [(E,2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-methyl-5-phenylpent-4-enyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C25H36O4SSi/c1-20-13-17-23(18-14-20)30(26,27)28-19-24(29-31(6,7)25(3,4)5)21(2)15-16-22-11-9-8-10-12-22/h8-18,21,24H,19H2,1-7H3/b16-15+/t21-,24+/m1/s1 |
| InChIKey | BKVPFMUEHHNOSB-OFLKIAERSA-N |
| XLogP | 6.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.71 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|