C28H35FO4SSi — CID 138975567
[4-[tert-butyl(diphenyl)silyl]oxy-5-fluoropentyl] 4-methylbenzenesulfonate (PubChem CID 138975567) has the molecular formula C28H35FO4SSi and a molecular weight of 514.74 g/mol. Its IUPAC name is [4-[tert-butyl(diphenyl)silyl]oxy-5-fluoropentyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[tert-butyl(diphenyl)silyl]oxy-5-fluoropentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 138975567 |
| Molecular Formula | C28H35FO4SSi |
| Molecular Weight | 514.74 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | [4-[tert-butyl(diphenyl)silyl]oxy-5-fluoropentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCC(CF)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H35FO4SSi/c1-23-17-19-25(20-18-23)34(30,31)32-21-11-12-24(22-29)33-35(28(2,3)4,26-13-7-5-8-14-26)27-15-9-6-10-16-27/h5-10,13-20,24H,11-12,21-22H2,1-4H3 |
| InChIKey | NAMSZIPUMQYILR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.74 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|