C28H50O4SSi — CID 101478840
[(4S,5R)-4-[tert-butyl(dimethyl)silyl]oxypentadec-1-en-5-yl] 4-methylbenzenesulfonate (PubChem CID 101478840) has the molecular formula C28H50O4SSi and a molecular weight of 510.86 g/mol. Its IUPAC name is [(4S,5R)-4-[tert-butyl(dimethyl)silyl]oxypentadec-1-en-5-yl] 4-methylbenzenesulfonate.
| Compound Name | [(4S,5R)-4-[tert-butyl(dimethyl)silyl]oxypentadec-1-en-5-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101478840 |
| Molecular Formula | C28H50O4SSi |
| Molecular Weight | 510.86 g/mol |
| Exact Mass | 510.32 |
| IUPAC Name | [(4S,5R)-4-[tert-butyl(dimethyl)silyl]oxypentadec-1-en-5-yl] 4-methylbenzenesulfonate |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CCCCCCCCCC)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H50O4SSi/c1-9-11-12-13-14-15-16-17-19-26(27(18-10-2)32-34(7,8)28(4,5)6)31-33(29,30)25-22-20-24(3)21-23-25/h10,20-23,26-27H,2,9,11-19H2,1,3-8H3/t26-,27+/m1/s1 |
| InChIKey | PMYGGGAVTMVDIA-SXOMAYOGSA-N |
| XLogP | 8.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.86 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|