C13H16O3S — CID 11043241
6-[(4-methylphenyl)sulfonylmethyl]-3,4-dihydro-2H-pyran (PubChem CID 11043241) has the molecular formula C13H16O3S and a molecular weight of 252.33 g/mol. Its IUPAC name is 6-[(4-methylphenyl)sulfonylmethyl]-3,4-dihydro-2H-pyran.
| Compound Name | 6-[(4-methylphenyl)sulfonylmethyl]-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 11043241 |
| Molecular Formula | C13H16O3S |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 6-[(4-methylphenyl)sulfonylmethyl]-3,4-dihydro-2H-pyran |
| SMILES | Cc1ccc(S(=O)(=O)CC2=CCCCO2)cc1 |
| InChI | InChI=1S/C13H16O3S/c1-11-5-7-13(8-6-11)17(14,15)10-12-4-2-3-9-16-12/h4-8H,2-3,9-10H2,1H3 |
| InChIKey | SXLFFERYZRYUTO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |