C21H34O4SSi — CID 154711724
tert-butyl-[2-[5,5-dimethyl-3-(4-methylphenyl)sulfonyl-2H-furan-2-yl]ethoxy]-dimethylsilane (PubChem CID 154711724) has the molecular formula C21H34O4SSi and a molecular weight of 410.65 g/mol. Its IUPAC name is tert-butyl-[2-[5,5-dimethyl-3-(4-methylphenyl)sulfonyl-2H-furan-2-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[5,5-dimethyl-3-(4-methylphenyl)sulfonyl-2H-furan-2-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 154711724 |
| Molecular Formula | C21H34O4SSi |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | tert-butyl-[2-[5,5-dimethyl-3-(4-methylphenyl)sulfonyl-2H-furan-2-yl]ethoxy]-dimethylsilane |
| SMILES | Cc1ccc(S(=O)(=O)C2=CC(C)(C)OC2CCO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H34O4SSi/c1-16-9-11-17(12-10-16)26(22,23)19-15-21(5,6)25-18(19)13-14-24-27(7,8)20(2,3)4/h9-12,15,18H,13-14H2,1-8H3 |
| InChIKey | RPQYIYTVQNAARY-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|