C23H38O4SSi — CID 102127109
2-[(2S,6R)-2-[(2R)-3-(benzenesulfonyl)-2-methylpropyl]-3,6-dihydro-2H-pyran-6-yl]ethoxy-tert-butyl-dimethylsilane (PubChem CID 102127109) has the molecular formula C23H38O4SSi and a molecular weight of 438.71 g/mol. Its IUPAC name is 2-[(2S,6R)-2-[(2R)-3-(benzenesulfonyl)-2-methylpropyl]-3,6-dihydro-2H-pyran-6-yl]ethoxy-tert-butyl-dimethylsilane.
| Compound Name | 2-[(2S,6R)-2-[(2R)-3-(benzenesulfonyl)-2-methylpropyl]-3,6-dihydro-2H-pyran-6-yl]ethoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102127109 |
| Molecular Formula | C23H38O4SSi |
| Molecular Weight | 438.71 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 2-[(2S,6R)-2-[(2R)-3-(benzenesulfonyl)-2-methylpropyl]-3,6-dihydro-2H-pyran-6-yl]ethoxy-tert-butyl-dimethylsilane |
| SMILES | C[C@H](C[C@@H]1CC=C[C@@H](CCO[Si](C)(C)C(C)(C)C)O1)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H38O4SSi/c1-19(18-28(24,25)22-13-8-7-9-14-22)17-21-12-10-11-20(27-21)15-16-26-29(5,6)23(2,3)4/h7-11,13-14,19-21H,12,15-18H2,1-6H3/t19-,20+,21+/m1/s1 |
| InChIKey | QYQFNTFZZMIYJJ-HKBOAZHASA-N |
| XLogP | 5.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.71 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|