C26H42O4SSi — CID 101161741
tert-butyl-[(2E,4Z)-6-[(4S,6R)-2,2-dimethyl-6-[(4-methylphenyl)sulfinylmethyl]-1,3-dioxan-4-yl]hexa-2,4-dienoxy]-dimethylsilane (PubChem CID 101161741) has the molecular formula C26H42O4SSi and a molecular weight of 478.77 g/mol. Its IUPAC name is tert-butyl-[(2E,4Z)-6-[(4S,6R)-2,2-dimethyl-6-[(4-methylphenyl)sulfinylmethyl]-1,3-dioxan-4-yl]hexa-2,4-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2E,4Z)-6-[(4S,6R)-2,2-dimethyl-6-[(4-methylphenyl)sulfinylmethyl]-1,3-dioxan-4-yl]hexa-2,4-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101161741 |
| Molecular Formula | C26H42O4SSi |
| Molecular Weight | 478.77 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | tert-butyl-[(2E,4Z)-6-[(4S,6R)-2,2-dimethyl-6-[(4-methylphenyl)sulfinylmethyl]-1,3-dioxan-4-yl]hexa-2,4-dienoxy]-dimethylsilane |
| SMILES | Cc1ccc(S(=O)C[C@H]2C[C@H](C/C=C\C=C\CO[Si](C)(C)C(C)(C)C)OC(C)(C)O2)cc1 |
| InChI | InChI=1S/C26H42O4SSi/c1-21-14-16-24(17-15-21)31(27)20-23-19-22(29-26(5,6)30-23)13-11-9-10-12-18-28-32(7,8)25(2,3)4/h9-12,14-17,22-23H,13,18-20H2,1-8H3/b11-9-,12-10+/t22-,23+,31?/m0/s1 |
| InChIKey | GOHQJULAKFBGAV-CBYXHZNASA-N |
| XLogP | 6.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.77 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|