C23H38O4SSi — CID 135012723
(2R,4S,6Z,8E)-10-[tert-butyl(dimethyl)silyl]oxy-1-(4-methylphenyl)sulfinyldeca-6,8-diene-2,4-diol (PubChem CID 135012723) has the molecular formula C23H38O4SSi and a molecular weight of 438.71 g/mol. Its IUPAC name is (2R,4S,6Z,8E)-10-[tert-butyl(dimethyl)silyl]oxy-1-(4-methylphenyl)sulfinyldeca-6,8-diene-2,4-diol.
| Compound Name | (2R,4S,6Z,8E)-10-[tert-butyl(dimethyl)silyl]oxy-1-(4-methylphenyl)sulfinyldeca-6,8-diene-2,4-diol |
|---|---|
| PubChem CID | 135012723 |
| Molecular Formula | C23H38O4SSi |
| Molecular Weight | 438.71 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | (2R,4S,6Z,8E)-10-[tert-butyl(dimethyl)silyl]oxy-1-(4-methylphenyl)sulfinyldeca-6,8-diene-2,4-diol |
| SMILES | Cc1ccc(S(=O)C[C@H](O)C[C@@H](O)C/C=C\C=C\CO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H38O4SSi/c1-19-12-14-22(15-13-19)28(26)18-21(25)17-20(24)11-9-7-8-10-16-27-29(5,6)23(2,3)4/h7-10,12-15,20-21,24-25H,11,16-18H2,1-6H3/b9-7-,10-8+/t20-,21+,28?/m0/s1 |
| InChIKey | BSPARPKDGATWHE-NDNSBVMJSA-N |
| XLogP | 4.74 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.71 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|