C21H30O2SSi — CID 73112372
tert-butyl-dimethyl-[2-(4-methylphenyl)sulfinyl-1-phenylethoxy]silane (PubChem CID 73112372) has the molecular formula C21H30O2SSi and a molecular weight of 374.62 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2-(4-methylphenyl)sulfinyl-1-phenylethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[2-(4-methylphenyl)sulfinyl-1-phenylethoxy]silane |
|---|---|
| PubChem CID | 73112372 |
| Molecular Formula | C21H30O2SSi |
| Molecular Weight | 374.62 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | tert-butyl-dimethyl-[2-(4-methylphenyl)sulfinyl-1-phenylethoxy]silane |
| SMILES | Cc1ccc(S(=O)CC(O[Si](C)(C)C(C)(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H30O2SSi/c1-17-12-14-19(15-13-17)24(22)16-20(18-10-8-7-9-11-18)23-25(5,6)21(2,3)4/h7-15,20H,16H2,1-6H3 |
| InChIKey | NEBYYFYQPJHIIE-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.62 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|