C23H30F2O3SSi — CID 173132149
tert-butyl-[(E)-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)but-2-enoxy]-dimethylsilane (PubChem CID 173132149) has the molecular formula C23H30F2O3SSi and a molecular weight of 452.64 g/mol. Its IUPAC name is tert-butyl-[(E)-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)but-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)but-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 173132149 |
| Molecular Formula | C23H30F2O3SSi |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | tert-butyl-[(E)-2-(3,4-difluorophenyl)-3-(4-methylsulfonylphenyl)but-2-enoxy]-dimethylsilane |
| SMILES | C/C(=C(\CO[Si](C)(C)C(C)(C)C)c1ccc(F)c(F)c1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C23H30F2O3SSi/c1-16(17-8-11-19(12-9-17)29(5,26)27)20(15-28-30(6,7)23(2,3)4)18-10-13-21(24)22(25)14-18/h8-14H,15H2,1-7H3/b20-16- |
| InChIKey | LTWGKPJFWBMBPT-SILNSSARSA-N |
| XLogP | 6.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|