C18H22F2OSSi — CID 132604593
[2,2-difluoro-2-(4-methylphenyl)sulfanyl-1-phenylethoxy]-trimethylsilane (PubChem CID 132604593) has the molecular formula C18H22F2OSSi and a molecular weight of 352.52 g/mol. Its IUPAC name is [2,2-difluoro-2-(4-methylphenyl)sulfanyl-1-phenylethoxy]-trimethylsilane.
| Compound Name | [2,2-difluoro-2-(4-methylphenyl)sulfanyl-1-phenylethoxy]-trimethylsilane |
|---|---|
| PubChem CID | 132604593 |
| Molecular Formula | C18H22F2OSSi |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | [2,2-difluoro-2-(4-methylphenyl)sulfanyl-1-phenylethoxy]-trimethylsilane |
| SMILES | Cc1ccc(SC(F)(F)C(O[Si](C)(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H22F2OSSi/c1-14-10-12-16(13-11-14)22-18(19,20)17(21-23(2,3)4)15-8-6-5-7-9-15/h5-13,17H,1-4H3 |
| InChIKey | MEHATZMTTBGCFB-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|