C16H28O2SSi — CID 12061432
tert-butyl-dimethyl-[(2S)-1-[(R)-(4-methylphenyl)sulfinyl]propan-2-yl]oxysilane (PubChem CID 12061432) has the molecular formula C16H28O2SSi and a molecular weight of 312.55 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2S)-1-[(R)-(4-methylphenyl)sulfinyl]propan-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2S)-1-[(R)-(4-methylphenyl)sulfinyl]propan-2-yl]oxysilane |
|---|---|
| PubChem CID | 12061432 |
| Molecular Formula | C16H28O2SSi |
| Molecular Weight | 312.55 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | tert-butyl-dimethyl-[(2S)-1-[(R)-(4-methylphenyl)sulfinyl]propan-2-yl]oxysilane |
| SMILES | Cc1ccc([S@](=O)C[C@H](C)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H28O2SSi/c1-13-8-10-15(11-9-13)19(17)12-14(2)18-20(6,7)16(3,4)5/h8-11,14H,12H2,1-7H3/t14-,19+/m0/s1 |
| InChIKey | OXYHUTHXVIOYHN-IFXJQAMLSA-N |
| XLogP | 4.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|