C16H24O2S — CID 14815249
(E,3R)-4-(4-methylphenyl)sulfinylnon-4-en-3-ol (PubChem CID 14815249) has the molecular formula C16H24O2S and a molecular weight of 280.43 g/mol. Its IUPAC name is (E,3R)-4-(4-methylphenyl)sulfinylnon-4-en-3-ol.
| Compound Name | (E,3R)-4-(4-methylphenyl)sulfinylnon-4-en-3-ol |
|---|---|
| PubChem CID | 14815249 |
| Molecular Formula | C16H24O2S |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (E,3R)-4-(4-methylphenyl)sulfinylnon-4-en-3-ol |
| SMILES | CCCC/C=C(\[C@H](O)CC)S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H24O2S/c1-4-6-7-8-16(15(17)5-2)19(18)14-11-9-13(3)10-12-14/h8-12,15,17H,4-7H2,1-3H3/b16-8+/t15-,19?/m1/s1 |
| InChIKey | WILFKMXXCYWYIM-FJNNBMMNSA-N |
| XLogP | 3.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|