C25H40O6SSi — CID 134970403
2-[(7S,8S,9S)-9-[2-(benzenesulfonyl)ethyl]-8-ethenyl-1,6,10-trioxaspiro[4.5]decan-7-yl]ethoxy-tert-butyl-dimethylsilane (PubChem CID 134970403) has the molecular formula C25H40O6SSi and a molecular weight of 496.74 g/mol. Its IUPAC name is 2-[(7S,8S,9S)-9-[2-(benzenesulfonyl)ethyl]-8-ethenyl-1,6,10-trioxaspiro[4.5]decan-7-yl]ethoxy-tert-butyl-dimethylsilane.
| Compound Name | 2-[(7S,8S,9S)-9-[2-(benzenesulfonyl)ethyl]-8-ethenyl-1,6,10-trioxaspiro[4.5]decan-7-yl]ethoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134970403 |
| Molecular Formula | C25H40O6SSi |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 2-[(7S,8S,9S)-9-[2-(benzenesulfonyl)ethyl]-8-ethenyl-1,6,10-trioxaspiro[4.5]decan-7-yl]ethoxy-tert-butyl-dimethylsilane |
| SMILES | C=C[C@H]1[C@H](CCO[Si](C)(C)C(C)(C)C)OC2(CCCO2)O[C@H]1CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H40O6SSi/c1-7-21-22(14-18-29-33(5,6)24(2,3)4)30-25(16-11-17-28-25)31-23(21)15-19-32(26,27)20-12-9-8-10-13-20/h7-10,12-13,21-23H,1,11,14-19H2,2-6H3/t21-,22-,23-,25?/m0/s1 |
| InChIKey | UBRMIMVBCFIEHJ-VMJHHUBKSA-N |
| XLogP | 5.31 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|