C23H34O5SSi — CID 134840173
[(4S)-5-(benzenesulfonyl)-4-but-3-enoxy-7-oxabicyclo[2.2.1]hept-2-en-1-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 134840173) has the molecular formula C23H34O5SSi and a molecular weight of 450.67 g/mol. Its IUPAC name is [(4S)-5-(benzenesulfonyl)-4-but-3-enoxy-7-oxabicyclo[2.2.1]hept-2-en-1-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(4S)-5-(benzenesulfonyl)-4-but-3-enoxy-7-oxabicyclo[2.2.1]hept-2-en-1-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134840173 |
| Molecular Formula | C23H34O5SSi |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | [(4S)-5-(benzenesulfonyl)-4-but-3-enoxy-7-oxabicyclo[2.2.1]hept-2-en-1-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C=CCCO[C@]12C=CC(CO[Si](C)(C)C(C)(C)C)(CC1S(=O)(=O)c1ccccc1)O2 |
| InChI | InChI=1S/C23H34O5SSi/c1-7-8-16-26-23-15-14-22(28-23,18-27-30(5,6)21(2,3)4)17-20(23)29(24,25)19-12-10-9-11-13-19/h7,9-15,20H,1,8,16-18H2,2-6H3/t20?,22?,23-/m0/s1 |
| InChIKey | MVDHEJCITWIGIE-SDVLMSEASA-N |
| XLogP | 4.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|