C24H34O5SSi — CID 134840174
[(4S)-5-(benzenesulfonyl)-4-cyclopent-3-en-1-yloxy-7-oxabicyclo[2.2.1]hept-2-en-1-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 134840174) has the molecular formula C24H34O5SSi and a molecular weight of 462.68 g/mol. Its IUPAC name is [(4S)-5-(benzenesulfonyl)-4-cyclopent-3-en-1-yloxy-7-oxabicyclo[2.2.1]hept-2-en-1-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(4S)-5-(benzenesulfonyl)-4-cyclopent-3-en-1-yloxy-7-oxabicyclo[2.2.1]hept-2-en-1-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134840174 |
| Molecular Formula | C24H34O5SSi |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | [(4S)-5-(benzenesulfonyl)-4-cyclopent-3-en-1-yloxy-7-oxabicyclo[2.2.1]hept-2-en-1-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC12C=C[C@](OC3CC=CC3)(O1)C(S(=O)(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C24H34O5SSi/c1-22(2,3)31(4,5)27-18-23-15-16-24(29-23,28-19-11-9-10-12-19)21(17-23)30(25,26)20-13-7-6-8-14-20/h6-10,13-16,19,21H,11-12,17-18H2,1-5H3/t21?,23?,24-/m0/s1 |
| InChIKey | JWTATASTKXBZNK-HQNXYIODSA-N |
| XLogP | 5.01 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|