C23H34O5SSi — CID 134840177
[(2S,4S)-4-(benzenesulfonyl)-2-ethenyl-1,10-dioxaspiro[4.5]dec-6-en-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 134840177) has the molecular formula C23H34O5SSi and a molecular weight of 450.67 g/mol. Its IUPAC name is [(2S,4S)-4-(benzenesulfonyl)-2-ethenyl-1,10-dioxaspiro[4.5]dec-6-en-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,4S)-4-(benzenesulfonyl)-2-ethenyl-1,10-dioxaspiro[4.5]dec-6-en-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134840177 |
| Molecular Formula | C23H34O5SSi |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | [(2S,4S)-4-(benzenesulfonyl)-2-ethenyl-1,10-dioxaspiro[4.5]dec-6-en-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C=C[C@]1(CO[Si](C)(C)C(C)(C)C)C[C@H](S(=O)(=O)c2ccccc2)C2(C=CCCO2)O1 |
| InChI | InChI=1S/C23H34O5SSi/c1-7-22(18-27-30(5,6)21(2,3)4)17-20(23(28-22)15-11-12-16-26-23)29(24,25)19-13-9-8-10-14-19/h7-11,13-15,20H,1,12,16-18H2,2-6H3/t20-,22+,23?/m0/s1 |
| InChIKey | DMXPAWWELWKSBQ-PDOMDSBESA-N |
| XLogP | 4.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|