C30H56O6SSi2 — CID 11376890
[(2S,3R,4R)-5-(benzenesulfonyl)-2-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylpentan-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11376890) has the molecular formula C30H56O6SSi2 and a molecular weight of 601.01 g/mol. Its IUPAC name is [(2S,3R,4R)-5-(benzenesulfonyl)-2-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylpentan-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,3R,4R)-5-(benzenesulfonyl)-2-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylpentan-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11376890 |
| Molecular Formula | C30H56O6SSi2 |
| Molecular Weight | 601.01 g/mol |
| Exact Mass | 600.33 |
| IUPAC Name | [(2S,3R,4R)-5-(benzenesulfonyl)-2-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylpentan-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@H]([C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CS(=O)(=O)c1ccccc1)[C@@H]1OC(C)(C)O[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H56O6SSi2/c1-22(21-37(31,32)24-18-16-15-17-19-24)26(36-39(13,14)29(6,7)8)23(2)27-25(34-30(9,10)35-27)20-33-38(11,12)28(3,4)5/h15-19,22-23,25-27H,20-21H2,1-14H3/t22-,23+,25-,26-,27-/m0/s1 |
| InChIKey | BBMUTXFTYZTYAB-BILQSEOESA-N |
| XLogP | 7.66 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.01 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|