C26H42O5SSi — CID 11103057
[(3S)-3-[(4S,5R,6R)-6-[(2R)-1-(benzenesulfonyl)propan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-3-methoxyprop-1-ynyl]-tert-butyl-dimethylsilane (PubChem CID 11103057) has the molecular formula C26H42O5SSi and a molecular weight of 494.77 g/mol. Its IUPAC name is [(3S)-3-[(4S,5R,6R)-6-[(2R)-1-(benzenesulfonyl)propan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-3-methoxyprop-1-ynyl]-tert-butyl-dimethylsilane.
| Compound Name | [(3S)-3-[(4S,5R,6R)-6-[(2R)-1-(benzenesulfonyl)propan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-3-methoxyprop-1-ynyl]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11103057 |
| Molecular Formula | C26H42O5SSi |
| Molecular Weight | 494.77 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | [(3S)-3-[(4S,5R,6R)-6-[(2R)-1-(benzenesulfonyl)propan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-3-methoxyprop-1-ynyl]-tert-butyl-dimethylsilane |
| SMILES | CO[C@@H](C#C[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@@H]([C@@H](C)CS(=O)(=O)c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C26H42O5SSi/c1-19(18-32(27,28)21-14-12-11-13-15-21)23-20(2)24(31-26(6,7)30-23)22(29-8)16-17-33(9,10)25(3,4)5/h11-15,19-20,22-24H,18H2,1-10H3/t19-,20+,22-,23-,24-/m0/s1 |
| InChIKey | YBLOUPXUAWDVSK-IOXZRWQCSA-N |
| XLogP | 5.32 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.77 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|