C20H36O5SSi — CID 134878980
[(2S,3S)-5-(benzenesulfonyl)-2-(methoxymethoxy)-3-methylpentoxy]-tert-butyl-dimethylsilane (PubChem CID 134878980) has the molecular formula C20H36O5SSi and a molecular weight of 416.66 g/mol. Its IUPAC name is [(2S,3S)-5-(benzenesulfonyl)-2-(methoxymethoxy)-3-methylpentoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(2S,3S)-5-(benzenesulfonyl)-2-(methoxymethoxy)-3-methylpentoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134878980 |
| Molecular Formula | C20H36O5SSi |
| Molecular Weight | 416.66 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | [(2S,3S)-5-(benzenesulfonyl)-2-(methoxymethoxy)-3-methylpentoxy]-tert-butyl-dimethylsilane |
| SMILES | COCO[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](C)CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H36O5SSi/c1-17(13-14-26(21,22)18-11-9-8-10-12-18)19(24-16-23-5)15-25-27(6,7)20(2,3)4/h8-12,17,19H,13-16H2,1-7H3/t17-,19+/m0/s1 |
| InChIKey | ICXZOMQBFGROTG-PKOBYXMFSA-N |
| XLogP | 4.50 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.66 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|