C16H24O5S — CID 15935897
[(E)-3-(2-methoxyethoxymethoxy)-4-methylpent-1-enyl]sulfonylbenzene (PubChem CID 15935897) has the molecular formula C16H24O5S and a molecular weight of 328.43 g/mol. Its IUPAC name is [(E)-3-(2-methoxyethoxymethoxy)-4-methylpent-1-enyl]sulfonylbenzene.
| Compound Name | [(E)-3-(2-methoxyethoxymethoxy)-4-methylpent-1-enyl]sulfonylbenzene |
|---|---|
| PubChem CID | 15935897 |
| Molecular Formula | C16H24O5S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | [(E)-3-(2-methoxyethoxymethoxy)-4-methylpent-1-enyl]sulfonylbenzene |
| SMILES | COCCOCOC(/C=C/S(=O)(=O)c1ccccc1)C(C)C |
| InChI | InChI=1S/C16H24O5S/c1-14(2)16(21-13-20-11-10-19-3)9-12-22(17,18)15-7-5-4-6-8-15/h4-9,12,14,16H,10-11,13H2,1-3H3/b12-9+ |
| InChIKey | QQYLPIHQPFIKAG-FMIVXFBMSA-N |
| XLogP | 2.64 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|