C16H20O4S — CID 11174306
[(E,3S)-3-(ethoxymethoxy)hept-1-en-6-ynyl]sulfonylbenzene (PubChem CID 11174306) has the molecular formula C16H20O4S and a molecular weight of 308.40 g/mol. Its IUPAC name is [(E,3S)-3-(ethoxymethoxy)hept-1-en-6-ynyl]sulfonylbenzene.
| Compound Name | [(E,3S)-3-(ethoxymethoxy)hept-1-en-6-ynyl]sulfonylbenzene |
|---|---|
| PubChem CID | 11174306 |
| Molecular Formula | C16H20O4S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | [(E,3S)-3-(ethoxymethoxy)hept-1-en-6-ynyl]sulfonylbenzene |
| SMILES | C#CCC[C@@H](/C=C/S(=O)(=O)c1ccccc1)OCOCC |
| InChI | InChI=1S/C16H20O4S/c1-3-5-9-15(20-14-19-4-2)12-13-21(17,18)16-10-7-6-8-11-16/h1,6-8,10-13,15H,4-5,9,14H2,2H3/b13-12+/t15-/m0/s1 |
| InChIKey | MBRQVAORIFTMEO-LHNRBYRGSA-N |
| XLogP | 2.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|