C13H17IO4S — CID 101242059
[(E,4S)-5-iodo-4-(methoxymethoxy)pent-2-enyl]sulfonylbenzene (PubChem CID 101242059) has the molecular formula C13H17IO4S and a molecular weight of 396.25 g/mol. Its IUPAC name is [(E,4S)-5-iodo-4-(methoxymethoxy)pent-2-enyl]sulfonylbenzene.
| Compound Name | [(E,4S)-5-iodo-4-(methoxymethoxy)pent-2-enyl]sulfonylbenzene |
|---|---|
| PubChem CID | 101242059 |
| Molecular Formula | C13H17IO4S |
| Molecular Weight | 396.25 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | [(E,4S)-5-iodo-4-(methoxymethoxy)pent-2-enyl]sulfonylbenzene |
| SMILES | COCO[C@@H](/C=C/CS(=O)(=O)c1ccccc1)CI |
| InChI | InChI=1S/C13H17IO4S/c1-17-11-18-12(10-14)6-5-9-19(15,16)13-7-3-2-4-8-13/h2-8,12H,9-11H2,1H3/b6-5+/t12-/m0/s1 |
| InChIKey | ABUJPGCLAAMPNM-FYJFLYSWSA-N |
| XLogP | 2.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|