C12H14O4S — CID 11482209
2-(benzenesulfonylmethyl)-4,7-dihydro-1,3-dioxepine (PubChem CID 11482209) has the molecular formula C12H14O4S and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-(benzenesulfonylmethyl)-4,7-dihydro-1,3-dioxepine.
| Compound Name | 2-(benzenesulfonylmethyl)-4,7-dihydro-1,3-dioxepine |
|---|---|
| PubChem CID | 11482209 |
| Molecular Formula | C12H14O4S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 2-(benzenesulfonylmethyl)-4,7-dihydro-1,3-dioxepine |
| SMILES | O=S(=O)(CC1OCC=CCO1)c1ccccc1 |
| InChI | InChI=1S/C12H14O4S/c13-17(14,11-6-2-1-3-7-11)10-12-15-8-4-5-9-16-12/h1-7,12H,8-10H2 |
| InChIKey | YGHLDUVQHXTDGS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|