C13H18O4S — CID 11054746
[(E,3S)-3-(methoxymethoxy)pent-1-enyl]sulfonylbenzene (PubChem CID 11054746) has the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. Its IUPAC name is [(E,3S)-3-(methoxymethoxy)pent-1-enyl]sulfonylbenzene.
| Compound Name | [(E,3S)-3-(methoxymethoxy)pent-1-enyl]sulfonylbenzene |
|---|---|
| PubChem CID | 11054746 |
| Molecular Formula | C13H18O4S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | [(E,3S)-3-(methoxymethoxy)pent-1-enyl]sulfonylbenzene |
| SMILES | CC[C@@H](/C=C/S(=O)(=O)c1ccccc1)OCOC |
| InChI | InChI=1S/C13H18O4S/c1-3-12(17-11-16-2)9-10-18(14,15)13-7-5-4-6-8-13/h4-10,12H,3,11H2,1-2H3/b10-9+/t12-/m0/s1 |
| InChIKey | DLOMHAROGQNCBY-VMPCVLLUSA-N |
| XLogP | 2.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|