C11H14O4S — CID 12827097
[(E)-3,3-dimethoxyprop-1-enyl]sulfonylbenzene (PubChem CID 12827097) has the molecular formula C11H14O4S and a molecular weight of 242.30 g/mol. Its IUPAC name is [(E)-3,3-dimethoxyprop-1-enyl]sulfonylbenzene.
| Compound Name | [(E)-3,3-dimethoxyprop-1-enyl]sulfonylbenzene |
|---|---|
| PubChem CID | 12827097 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | [(E)-3,3-dimethoxyprop-1-enyl]sulfonylbenzene |
| SMILES | COC(/C=C/S(=O)(=O)c1ccccc1)OC |
| InChI | InChI=1S/C11H14O4S/c1-14-11(15-2)8-9-16(12,13)10-6-4-3-5-7-10/h3-9,11H,1-2H3/b9-8+ |
| InChIKey | GKQMEFLQWDPEHR-CMDGGOBGSA-N |
| XLogP | 1.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|