C30H58O6SSi3 — CID 134882885
[(2R,3R,4R)-6-(benzenesulfonyl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxan-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 134882885) has the molecular formula C30H58O6SSi3 and a molecular weight of 631.11 g/mol. Its IUPAC name is [(2R,3R,4R)-6-(benzenesulfonyl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxan-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R,4R)-6-(benzenesulfonyl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxan-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134882885 |
| Molecular Formula | C30H58O6SSi3 |
| Molecular Weight | 631.11 g/mol |
| Exact Mass | 630.33 |
| IUPAC Name | [(2R,3R,4R)-6-(benzenesulfonyl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]oxan-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1OC(S(=O)(=O)c2ccccc2)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H58O6SSi3/c1-28(2,3)38(10,11)33-22-25-27(36-40(14,15)30(7,8)9)24(35-39(12,13)29(4,5)6)21-26(34-25)37(31,32)23-19-17-16-18-20-23/h16-20,24-27H,21-22H2,1-15H3/t24-,25-,26?,27+/m1/s1 |
| InChIKey | YNRVDORGXZIPTD-GWDBROLASA-N |
| XLogP | 8.38 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.11 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|