C24H42O7SSi — CID 71490041
[(1R,2S,4R)-5-(benzenesulfonyl)-1-(methoxymethoxy)-4-methyl-1-(2-methyl-1,3-dioxolan-2-yl)pentan-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 71490041) has the molecular formula C24H42O7SSi and a molecular weight of 502.75 g/mol. Its IUPAC name is [(1R,2S,4R)-5-(benzenesulfonyl)-1-(methoxymethoxy)-4-methyl-1-(2-methyl-1,3-dioxolan-2-yl)pentan-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,2S,4R)-5-(benzenesulfonyl)-1-(methoxymethoxy)-4-methyl-1-(2-methyl-1,3-dioxolan-2-yl)pentan-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 71490041 |
| Molecular Formula | C24H42O7SSi |
| Molecular Weight | 502.75 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | [(1R,2S,4R)-5-(benzenesulfonyl)-1-(methoxymethoxy)-4-methyl-1-(2-methyl-1,3-dioxolan-2-yl)pentan-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COCO[C@H]([C@H](C[C@@H](C)CS(=O)(=O)c1ccccc1)O[Si](C)(C)C(C)(C)C)C1(C)OCCO1 |
| InChI | InChI=1S/C24H42O7SSi/c1-19(17-32(25,26)20-12-10-9-11-13-20)16-21(31-33(7,8)23(2,3)4)22(28-18-27-6)24(5)29-14-15-30-24/h9-13,19,21-22H,14-18H2,1-8H3/t19-,21+,22-/m1/s1 |
| InChIKey | IAWDKHJPFWGGAR-BAGYTPMASA-N |
| XLogP | 4.63 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.75 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|