C29H46O5SSi — CID 10602409
[(4'aS,5'R,8'S,9'Z,10'aS)-5'-(benzenesulfonyl)-7',7',10'a-trimethylspiro[1,3-dioxolane-2,3'-2,4,4a,5,6,8-hexahydro-1H-benzo[8]annulene]-8'-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10602409) has the molecular formula C29H46O5SSi and a molecular weight of 534.84 g/mol. Its IUPAC name is [(4'aS,5'R,8'S,9'Z,10'aS)-5'-(benzenesulfonyl)-7',7',10'a-trimethylspiro[1,3-dioxolane-2,3'-2,4,4a,5,6,8-hexahydro-1H-benzo[8]annulene]-8'-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(4'aS,5'R,8'S,9'Z,10'aS)-5'-(benzenesulfonyl)-7',7',10'a-trimethylspiro[1,3-dioxolane-2,3'-2,4,4a,5,6,8-hexahydro-1H-benzo[8]annulene]-8'-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10602409 |
| Molecular Formula | C29H46O5SSi |
| Molecular Weight | 534.84 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | [(4'aS,5'R,8'S,9'Z,10'aS)-5'-(benzenesulfonyl)-7',7',10'a-trimethylspiro[1,3-dioxolane-2,3'-2,4,4a,5,6,8-hexahydro-1H-benzo[8]annulene]-8'-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)C[C@@H](S(=O)(=O)c2ccccc2)[C@H]2CC3(CC[C@@]2(C)/C=C\[C@@H]1O[Si](C)(C)C(C)(C)C)OCCO3 |
| InChI | InChI=1S/C29H46O5SSi/c1-26(2,3)36(7,8)34-25-14-15-28(6)16-17-29(32-18-19-33-29)20-23(28)24(21-27(25,4)5)35(30,31)22-12-10-9-11-13-22/h9-15,23-25H,16-21H2,1-8H3/b15-14-/t23-,24-,25+,28-/m1/s1 |
| InChIKey | YUEVXQOVNXNJAF-KSUFNVAGSA-N |
| XLogP | 6.75 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.84 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|