C29H44O5SSi — CID 10530313
[(4aS,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-3-(methoxymethoxy)-7,7,10a-trimethyl-4a,5,6,8-tetrahydrobenzo[8]annulen-8-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10530313) has the molecular formula C29H44O5SSi and a molecular weight of 532.82 g/mol. Its IUPAC name is [(4aS,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-3-(methoxymethoxy)-7,7,10a-trimethyl-4a,5,6,8-tetrahydrobenzo[8]annulen-8-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(4aS,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-3-(methoxymethoxy)-7,7,10a-trimethyl-4a,5,6,8-tetrahydrobenzo[8]annulen-8-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10530313 |
| Molecular Formula | C29H44O5SSi |
| Molecular Weight | 532.82 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | [(4aS,5R,8S,9Z,10aR)-5-(benzenesulfonyl)-3-(methoxymethoxy)-7,7,10a-trimethyl-4a,5,6,8-tetrahydrobenzo[8]annulen-8-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COCOC1=C[C@@H]2[C@H](S(=O)(=O)c3ccccc3)CC(C)(C)[C@@H](O[Si](C)(C)C(C)(C)C)/C=C\[C@]2(C)C=C1 |
| InChI | InChI=1S/C29H44O5SSi/c1-27(2,3)36(8,9)34-26-16-18-29(6)17-15-22(33-21-32-7)19-24(29)25(20-28(26,4)5)35(30,31)23-13-11-10-12-14-23/h10-19,24-26H,20-21H2,1-9H3/b18-16-/t24-,25-,26+,29+/m1/s1 |
| InChIKey | KFZCNWBBRDXJRH-XKTWOYMFSA-N |
| XLogP | 6.90 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.82 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|