C26H43LiO5SSi — CID 10413737
lithium [(1R,2R,3Z)-3-[2-(benzenesulfonyl)ethylidene]-2-(1-ethoxyethoxy)-1-methylcyclohexyl]methoxy-tert-butyl-dimethylsilane (PubChem CID 10413737) has the molecular formula C26H43LiO5SSi and a molecular weight of 502.72 g/mol. Its IUPAC name is lithium [(1R,2R,3Z)-3-[2-(benzenesulfonyl)ethylidene]-2-(1-ethoxyethoxy)-1-methylcyclohexyl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | lithium [(1R,2R,3Z)-3-[2-(benzenesulfonyl)ethylidene]-2-(1-ethoxyethoxy)-1-methylcyclohexyl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10413737 |
| Molecular Formula | C26H43LiO5SSi |
| Molecular Weight | 502.72 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | lithium [(1R,2R,3Z)-3-[2-(benzenesulfonyl)ethylidene]-2-(1-ethoxyethoxy)-1-methylcyclohexyl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CCOC(C)O[C@@H]1/C(=C\[CH-]S(=O)(=O)c2ccccc2)CCC[C@]1(C)CO[Si](C)(C)C(C)(C)C.[Li+] |
| InChI | InChI=1S/C26H43O5SSi.Li/c1-9-29-21(2)31-24-22(17-19-32(27,28)23-15-11-10-12-16-23)14-13-18-26(24,6)20-30-33(7,8)25(3,4)5;/h10-12,15-17,19,21,24H,9,13-14,18,20H2,1-8H3;/q-1;+1/b22-17-;/t21?,24-,26-;/m1./s1 |
| InChIKey | DBLWUYAHKPVSLX-WVBPPFNNSA-N |
| XLogP | 3.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.72 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|