C32H50O6S — CID 134887243
[(E)-9-(benzenesulfonyl)-8-(1-ethoxyethoxy)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)non-2-enyl] acetate (PubChem CID 134887243) has the molecular formula C32H50O6S and a molecular weight of 562.81 g/mol. Its IUPAC name is [(E)-9-(benzenesulfonyl)-8-(1-ethoxyethoxy)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)non-2-enyl] acetate.
| Compound Name | [(E)-9-(benzenesulfonyl)-8-(1-ethoxyethoxy)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)non-2-enyl] acetate |
|---|---|
| PubChem CID | 134887243 |
| Molecular Formula | C32H50O6S |
| Molecular Weight | 562.81 g/mol |
| Exact Mass | 562.33 |
| IUPAC Name | [(E)-9-(benzenesulfonyl)-8-(1-ethoxyethoxy)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)non-2-enyl] acetate |
| SMILES | CCOC(C)OC(C(C)CCC/C(C)=C/COC(C)=O)C(C1=C(C)CCCC1(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H50O6S/c1-9-36-27(6)38-30(25(4)16-13-15-23(2)20-22-37-26(5)33)31(29-24(3)17-14-21-32(29,7)8)39(34,35)28-18-11-10-12-19-28/h10-12,18-20,25,27,30-31H,9,13-17,21-22H2,1-8H3/b23-20+ |
| InChIKey | YNGHDEDOYGVZQQ-BSYVCWPDSA-N |
| XLogP | 7.44 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.81 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|