C29H46O6S — CID 13265394
[4-(benzenesulfonyl)-2-methyl-6-(oxan-2-yloxy)pentadec-2-en-5-yl] acetate (PubChem CID 13265394) has the molecular formula C29H46O6S and a molecular weight of 522.75 g/mol. Its IUPAC name is [4-(benzenesulfonyl)-2-methyl-6-(oxan-2-yloxy)pentadec-2-en-5-yl] acetate.
| Compound Name | [4-(benzenesulfonyl)-2-methyl-6-(oxan-2-yloxy)pentadec-2-en-5-yl] acetate |
|---|---|
| PubChem CID | 13265394 |
| Molecular Formula | C29H46O6S |
| Molecular Weight | 522.75 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | [4-(benzenesulfonyl)-2-methyl-6-(oxan-2-yloxy)pentadec-2-en-5-yl] acetate |
| SMILES | CCCCCCCCCC(OC1CCCCO1)C(OC(C)=O)C(C=C(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H46O6S/c1-5-6-7-8-9-10-14-19-26(35-28-20-15-16-21-33-28)29(34-24(4)30)27(22-23(2)3)36(31,32)25-17-12-11-13-18-25/h11-13,17-18,22,26-29H,5-10,14-16,19-21H2,1-4H3 |
| InChIKey | NSZJSXAFYHBOLY-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.75 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|